| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:10 UTC |
|---|
| Update Date | 2025-03-21 18:32:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093620 |
|---|
| Frequency | 29.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13NO8S |
|---|
| Molecular Mass | 259.0362 |
|---|
| SMILES | O=S(=O)(O)NC1C(O)C(O)C(O)C(O)C1O |
|---|
| InChI Key | ZPJDSBYZXSTWQR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | sulfamic acid derivatives |
|---|
| Subclass | cyclamates |
|---|
| Direct Parent | cyclamates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativescyclohexanolshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfuric acid monoamides |
|---|
| Substituents | alcoholorganic sulfuric acid or derivativescyclohexanolcyclamic_acid_derivativecyclitol or derivativescyclic alcoholorganic oxideorganic oxygen compoundorganonitrogen compoundsulfuric acid monoamidesecondary alcoholaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|