| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:11 UTC |
|---|
| Update Date | 2025-03-21 18:32:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093669 |
|---|
| Frequency | 29.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10ClN5O2 |
|---|
| Molecular Mass | 267.0523 |
|---|
| SMILES | N=C(Nc1ccc(Cl)cc1)NC1NC(=O)NC1=O |
|---|
| InChI Key | PWDFGWSLEUYSOQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | hydantoins |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaryl chloridesazacyclic compoundscarbonyl compoundscarboximidamidescarboxylic acids and derivativeschlorobenzenesdicarboximidesguanidineshydrocarbon derivativesimidazolidinonesiminesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganopnictogen compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundguanidineimineorganochloridealpha-amino acid or derivativescarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidearyl chloridechlorobenzenecarbonic acid derivativeazacyclecarboximidamidearyl halideorganic oxygen compoundhydantoinhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
