| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:13:15 UTC |
|---|
| Update Date | 2025-03-21 18:33:00 UTC |
|---|
| HMDB ID | HMDB0128033 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093812 |
|---|
| Name | 6-(3-carboxy-5-methoxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Frequency | 29.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16O10 |
|---|
| Molecular Mass | 344.0743 |
|---|
| SMILES | COc1cc(OC2OC(C(=O)O)C(O)C(O)C2O)cc(C(=O)O)c1 |
|---|
| InChI Key | YAPRVMZPLICDSY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersanisolesbenzoic acidsbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesm-methoxybenzoic acids and derivativesmethoxybenzenesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundbenzoylo-glucuronidemonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalbenzoic acidm-methoxybenzoic acid or derivativesoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesbenzoic acid or derivativeshydroxy acidmethoxybenzeneoxacyclepyrananisolesecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidphenoxy compound |
|---|