| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:16 UTC |
|---|
| Update Date | 2025-03-21 18:33:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093882 |
|---|
| Frequency | 29.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10Cl2O5 |
|---|
| Molecular Mass | 279.9905 |
|---|
| SMILES | O=C(O)C(O)C(O)COc1ccc(Cl)cc1Cl |
|---|
| InChI Key | WWPXNFWSHWHBKW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | dichlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl aryl ethersalpha hydroxy acids and derivativesaryl chloridesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesphenol ethersphenoxy compoundssecondary alcohols |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidorganochloridealpha-hydroxy acidmonosaccharidealkyl aryl ethercarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzenebeta-hydroxy acidsaccharideorganic oxide1,2-diolaryl chloridealcoholhydroxy acidaryl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
