| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:17 UTC |
|---|
| Update Date | 2025-03-21 18:33:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093902 |
|---|
| Frequency | 29.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13NO7S |
|---|
| Molecular Mass | 255.0413 |
|---|
| SMILES | CC1(C)OC2COC(COS(N)(=O)=O)(O2)O1 |
|---|
| InChI Key | IUVLWDLLGIKQGV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | orthocarboxylic acid derivatives |
|---|
| Subclass | carboxylic acid orthoesters |
|---|
| Direct Parent | carboxylic acid orthoesters |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolaneshydrocarbon derivativesketalsorganic nitrogen compoundsorganic oxidesorganic sulfuric acids and derivativesortho estersoxacyclic compoundstrioxanes |
|---|
| Substituents | meta-dioxolaneorganic sulfuric acid or derivativesortho ester1,3,5-trioxanecarboxylic acid orthoesteraliphatic heteropolycyclic compoundoxacycleorganic oxideorganic oxygen compoundacetalketalhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|