| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:21 UTC |
|---|
| Update Date | 2025-03-21 18:33:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00094044 |
|---|
| Frequency | 29.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H22O5 |
|---|
| Molecular Mass | 294.1467 |
|---|
| SMILES | CCC(CCC(C)O)COC(=O)c1cccc(C(=O)O)c1 |
|---|
| InChI Key | SXAQBAAZDISELS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-phthalate esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoic acid estersbenzoic acidsbenzoyl derivativescarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesfatty alcoholshydrocarbon derivativesm-phthalic acid and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholfatty acylmeta-phthalic acid estercarboxylic acidbenzoylbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundfatty alcoholcarboxylic acid estersecondary alcoholdicarboxylic acid or derivativesmeta_phthalic_acidhydrocarbon derivativebenzoic acidorganooxygen compound |
|---|