| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:23 UTC |
|---|
| Update Date | 2025-03-21 18:33:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00094129 |
|---|
| Frequency | 29.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7F3O2 |
|---|
| Molecular Mass | 204.0398 |
|---|
| SMILES | COC(=O)c1cccc(C(F)(F)F)c1 |
|---|
| InChI Key | QQHNNQCWKYFNAC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesbenzoyl derivativeshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganooxygen compoundstrifluoromethylbenzenes |
|---|
| Substituents | alkyl fluorideorganofluoridebenzoylbenzoate estercarboxylic acid derivativeorganohalogen compoundaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesmethyl esterorganic oxygen compoundcarboxylic acid esteralkyl halidehydrocarbon derivativetrifluoromethylbenzeneorganooxygen compound |
|---|
