| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:24 UTC |
|---|
| Update Date | 2025-03-21 18:33:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00094177 |
|---|
| Frequency | 29.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21NO5 |
|---|
| Molecular Mass | 319.142 |
|---|
| SMILES | CN1C2CC(OC(=O)C(CO)c3ccccc3)CC1C1OC2O1 |
|---|
| InChI Key | BYUBQQXAPBJGLX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersdioxetaneshydrocarbon derivativesmonocarboxylic acids and derivativesmorpholinesorganic oxidesorganopnictogen compoundsoxacyclic compoundspiperidinesprimary alcoholstrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupamino acid or derivativescarboxylic acid derivative1,3-dioxetanebeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholpiperidinetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic amineoxazinaneoxacyclemorpholinemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
