| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:30 UTC |
|---|
| Update Date | 2025-03-21 18:33:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00094421 |
|---|
| Frequency | 29.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H13NO5S |
|---|
| Molecular Mass | 319.0514 |
|---|
| SMILES | O=S(=O)(O)OC(c1ccc(O)cc1)c1c[nH]c2ccccc12 |
|---|
| InChI Key | FQGBDEUSOAPRII-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl sulfatesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrolessulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesterorganic sulfuric acid or derivativesazacycleindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundalkyl sulfatepyrroleorganonitrogen compoundorganopnictogen compoundsulfate-esterphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|
