| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:31 UTC |
|---|
| Update Date | 2025-03-21 18:33:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00094423 |
|---|
| Frequency | 29.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H11N2O6P |
|---|
| Molecular Mass | 226.0355 |
|---|
| SMILES | NC(=O)CCC(NP(=O)(O)O)C(=O)O |
|---|
| InChI Key | BEWZOYANBGCCRH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsfatty acids and conjugatesfatty amideshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoramidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidefatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidglutamine or derivativesfatty amidefatty acidcarboxamide grouporganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganic phosphoric acid amideorganooxygen compound |
|---|