Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-21 00:13:34 UTC |
---|
Update Date | 2025-03-21 18:33:10 UTC |
---|
HMDB ID | HMDB0126039 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00094560 |
---|
Name | 5,7-dihydroxy-2-(2,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-one |
---|
Frequency | 29.4 |
---|
Structure | |
---|
Chemical Formula | C15H12O7 |
---|
Molecular Mass | 304.0583 |
---|
SMILES | O=C1CC(c2cc(O)c(O)cc2O)Oc2cc(O)cc(O)c21 |
---|
InChI Key | YLKSVXKBXCRYAD-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | flavans |
---|
Direct Parent | flavanones |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativeschromoneshydrocarbon derivativesorganic oxidesoxacyclic compoundsvinylogous acids |
---|
Substituents | monocyclic benzene moietyetheraryl alkyl ketone1-benzopyranflavanone1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketoneorganic oxidechromonearomatic heteropolycyclic compoundchromaneorganoheterocyclic compoundbenzopyran5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacyclevinylogous acidorganic oxygen compound7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
---|