| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:37 UTC |
|---|
| Update Date | 2025-03-21 18:33:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00094688 |
|---|
| Frequency | 29.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H32O17 |
|---|
| Molecular Mass | 640.164 |
|---|
| SMILES | CC1OC(OCC2OC(Oc3c(-c4ccc(O)c(O)c4)oc4c(O)cc(O)cc4c3=O)C(O)C(O)C(O)C2O)C(O)C(O)C1O |
|---|
| InChI Key | HPLVEBJWIRBEEV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 8-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids6-hydroxyflavonoidsacetalsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesoxepanespyranones and derivativessecondary alcohols |
|---|
| Substituents | 8-hydroxyflavonoidmonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidmonosaccharidesaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundpyranoneoxaneorganoheterocyclic compoundalcoholbenzopyran6-hydroxyflavonoidheteroaromatic compound1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxepaneoxacycleorganic oxygen compoundpyransecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|