Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:13:38 UTC |
---|
Update Date | 2025-03-21 18:33:13 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00094726 |
---|
Frequency | 29.3 |
---|
Structure | |
---|
Chemical Formula | C15H23NO13 |
---|
Molecular Mass | 425.1169 |
---|
SMILES | CC(=O)NC1C(O)CC(OCC2OC(O)C(O)C(O)C2O)(C(=O)O)OC1C(=O)O |
---|
InChI Key | DISYQZWKTPPOLC-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pyrans |
---|
Subclass | pyran carboxylic acids and derivatives |
---|
Direct Parent | pyran carboxylic acids |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | acetamidescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesketalsmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssecondary carboxylic acid amides |
---|
Substituents | carbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneacetamidealcoholpyran carboxylic acid or derivativescarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|