| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:39 UTC |
|---|
| Update Date | 2025-03-21 18:33:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00094751 |
|---|
| Frequency | 29.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO3S |
|---|
| Molecular Mass | 223.0303 |
|---|
| SMILES | NS(=O)(=O)c1cccc2ccc(O)cc12 |
|---|
| InChI Key | MAWIDBJNNAMASW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-naphthalene sulfonamidesaminosulfonyl compoundshydrocarbon derivativesnaphthols and derivativesorganic nitrogen compoundsorganic oxidesorganooxygen compoundsorganosulfonamides |
|---|
| Substituents | organosulfonic acid or derivativesaminosulfonyl compound1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundnaphthalene sulfonamideorganosulfur compound1-naphthalene sulfonic acid or derivativesorganosulfonic acid amideorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compound2-naphthol1-naphthalene sulfonamideorganooxygen compound |
|---|
