| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:48 UTC |
|---|
| Update Date | 2025-03-21 18:33:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095098 |
|---|
| Frequency | 29.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H7NO6S |
|---|
| Molecular Mass | 196.9994 |
|---|
| SMILES | NC(CC(=O)S(=O)(=O)O)C(=O)O |
|---|
| InChI Key | VPXFCHLHZMKDIX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acylsulfonic acidscarbonyl compoundscarboxylic acidsfatty acids and conjugateshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganic sulfonic acids and derivativesorganonitrogen compoundsorganopnictogen compoundssulfonylsthiolactones |
|---|
| Substituents | acylsulfonic acidaliphatic acyclic compoundcarbonyl groupcarboxylic acidacylsulfonic acid or derivativesfatty acidorganosulfur compoundorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundthiolactoneorganooxygen compound |
|---|
