| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:48 UTC |
|---|
| Update Date | 2025-03-21 18:33:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095115 |
|---|
| Frequency | 29.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H26N2O4 |
|---|
| Molecular Mass | 322.1893 |
|---|
| SMILES | CN(C)CC(O)C(Cc1ccccc1)NC(=O)OC1CCOC1 |
|---|
| InChI Key | SKXLTTYDNKILNW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsamphetamines and derivativescarbamate esterscarbonyl compoundsdialkyl ethershydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofuranstrialkylamines |
|---|
| Substituents | carbonyl groupetheraromatic heteromonocyclic compounddialkyl etherorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundamphetamine or derivativesalcoholcarbonic acid derivative1,2-aminoalcoholtetrahydrofurantertiary aliphatic aminecarbamic acid esteroxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|