Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:13:48 UTC |
---|
Update Date | 2025-03-21 18:33:17 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00095118 |
---|
Frequency | 29.2 |
---|
Structure | |
---|
Chemical Formula | C7H6ClNO4S |
---|
Molecular Mass | 234.9706 |
---|
SMILES | NS(=O)(=O)c1cc(Cl)ccc1C(=O)O |
---|
InChI Key | UJRFKPXGAPWRBG-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzenesulfonamides |
---|
Direct Parent | benzenesulfonamides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-carboxy-2-haloaromatic compounds4-halobenzoic acidsaminosulfonyl compoundsaryl chloridesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativeschlorobenzeneshalobenzoic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganochloridesorganooxygen compoundsorganosulfonamides |
---|
Substituents | organosulfonic acid or derivativescarboxylic acidorganochloridebenzoylorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxide1-carboxy-2-haloaromatic compoundbenzoic acidbenzenesulfonyl grouparyl chloridechlorobenzenehalobenzoic acidbenzenesulfonamide4-halobenzoic acidaminosulfonyl compoundbenzoic acid or derivativeshalobenzoic acid or derivativesaryl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
---|