| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:51 UTC |
|---|
| Update Date | 2025-03-21 18:33:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095246 |
|---|
| Frequency | 29.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20NO10P |
|---|
| Molecular Mass | 393.0825 |
|---|
| SMILES | CC(=O)Nc1ccc(OC2OC(COP(=O)(O)O)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | QHSLIUFZDXWYPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesacetanilidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupn-acetylarylaminearomatic heteromonocyclic compoundn-arylamidecarboxylic acid derivativeorganic oxideacetalorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundacetamidealcoholacetanilidecarboxamide groupanilideoxacyclesecondary carboxylic acid amidephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
