| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:52 UTC |
|---|
| Update Date | 2025-03-21 18:33:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095260 |
|---|
| Frequency | 29.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12O5 |
|---|
| Molecular Mass | 236.0685 |
|---|
| SMILES | CC(CC(=O)c1ccccc1C(=O)O)C(=O)O |
|---|
| InChI Key | GVHQQFYKQLTKHW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsaryl alkyl ketonesbenzoic acidsbenzoyl derivativesbutyrophenonesdicarboxylic acids and derivativesgamma-keto acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidaryl alkyl ketonebenzoylbenzoic acid or derivativescarboxylic acid derivativegamma-keto acidbutyrophenonearomatic homomonocyclic compoundorganic oxideketo aciddicarboxylic acid or derivativeshydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundbenzoic acidalkyl-phenylketone |
|---|
