| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:52 UTC |
|---|
| Update Date | 2025-03-21 18:33:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095275 |
|---|
| Frequency | 29.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H10O5 |
|---|
| Molecular Mass | 282.0528 |
|---|
| SMILES | O=C1Cc2cc3c(cc2-c2cc4c(cc21)OCO4)OCO3 |
|---|
| InChI Key | LFVYRVLZZWQJSE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsaryl alkyl ketonesbenzodioxoleshydrocarbon derivativesnaphthalenesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | phenanthrenearyl alkyl ketoneketoneoxacycleorganic oxidenaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compoundaryl ketonebenzodioxole |
|---|
