| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:53 UTC |
|---|
| Update Date | 2025-03-21 18:33:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095301 |
|---|
| Frequency | 29.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19NO3 |
|---|
| Molecular Mass | 213.1365 |
|---|
| SMILES | CN1C2CCC1C(CCC(=O)O)C(O)C2 |
|---|
| InChI Key | MDVKTYSFNBOEOH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | tropane alkaloids |
|---|
| Subclass | tropane alkaloids |
|---|
| Direct Parent | tropane alkaloids |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundspiperidinessecondary alcoholstrialkylamines |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acid or derivativesamino acidcarboxylic acid derivativealiphatic heteropolycyclic compoundorganic oxideorganonitrogen compoundorganopnictogen compoundpyrrolidinepiperidinetertiary amineorganoheterocyclic compoundalcoholazacyclen-alkylpyrrolidinetertiary aliphatic aminecyclic alcoholmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundtropane alkaloidamineorganooxygen compound |
|---|
