| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:53 UTC |
|---|
| Update Date | 2025-03-21 18:33:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095318 |
|---|
| Frequency | 29.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O3 |
|---|
| Molecular Mass | 240.0786 |
|---|
| SMILES | COC(=O)c1cccc(C(=O)c2ccccc2)c1 |
|---|
| InChI Key | FOBUHGGUSGQWRJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl ketonesaryl-phenylketonesbenzoic acid estersbenzoyl derivativesdiphenylmethaneshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | diphenylmethanearyl-phenylketonebenzoylbenzoic acid or derivativesbenzoate estercarboxylic acid derivativebenzophenoneketonearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesmethyl esterorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
