| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:56 UTC |
|---|
| Update Date | 2025-03-21 18:33:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095425 |
|---|
| Frequency | 29.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12N2O4S |
|---|
| Molecular Mass | 280.0518 |
|---|
| SMILES | Cc1ccc(C(=O)O)n1-c1ccc(S(N)(=O)=O)cc1 |
|---|
| InChI Key | ZNBOKTIBIVOODN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsazacyclic compoundsbenzenesulfonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfonamidespyrrole 2-carboxylic acidspyrrole carboxylic acids and derivativessubstituted pyrroles |
|---|
| Substituents | organosulfonic acid or derivativescarboxylic acidaromatic heteromonocyclic compoundsubstituted pyrroleorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amideorganic oxidepyrrole-2-carboxylic acidpyrrole-2-carboxylic acid or derivativesorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundbenzenesulfonyl groupbenzenesulfonamideazacycleaminosulfonyl compoundheteroaromatic compoundmonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativespyrrolehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
