| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:57 UTC |
|---|
| Update Date | 2025-03-21 18:33:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095468 |
|---|
| Frequency | 46.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13NO8 |
|---|
| Molecular Mass | 263.0641 |
|---|
| SMILES | O=C(O)CCC(O)(CC(O)=NCC(=O)O)C(=O)O |
|---|
| InChI Key | BVJDOJFMBTYSSO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboximidic acidscarboxylic acidshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundstertiary alcoholstricarboxylic acids and derivatives |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarboximidic acidcarbonyl groupcarboxylic acidalpha-hydroxy acidtricarboxylic acid or derivativesorganic 1,3-dipolar compoundhydroxy acidpropargyl-type 1,3-dipolar organic compoundtertiary alcoholorganic oxideorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
