| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:59 UTC |
|---|
| Update Date | 2025-03-21 18:33:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095564 |
|---|
| Frequency | 29.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15NO7 |
|---|
| Molecular Mass | 237.0849 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)C(O)OC1C(O)O |
|---|
| InChI Key | QHIXAOAVQQDPRK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,1-diols1,2-diolsacetamidescarbonyl compoundscarbonyl hydratescarboxylic acids and derivativeshemiacetalshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarbonyl hydratemonosaccharidecarboxylic acid derivativeorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundacetamide1,2-diolalcohol1,1-diolcarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|
