| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:00 UTC |
|---|
| Update Date | 2025-03-21 18:33:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095609 |
|---|
| Frequency | 29.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H18N2O6 |
|---|
| Molecular Mass | 250.1165 |
|---|
| SMILES | NCCC(=O)NC1C(O)OC(CO)C(O)C1O |
|---|
| InChI Key | JHMFYIBLCPMBNK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | beta amino acids and derivativescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonoalkylaminesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholcarboxamide groupbeta amino acid or derivativesacylaminosugaroxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound |
|---|