Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-21 00:14:02 UTC |
---|
Update Date | 2025-03-21 18:33:24 UTC |
---|
HMDB ID | HMDB0029228 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00095671 |
---|
Name | 4-Methyl-epicatechin |
---|
Frequency | 29.0 |
---|
Structure | |
---|
Chemical Formula | C16H16O6 |
---|
Molecular Mass | 304.0947 |
---|
SMILES | CC1c2c(O)cc(O)cc2OC(c2ccc(O)c(O)c2)C1O |
---|
InChI Key | NLCHNUHNZBPKDF-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | flavans |
---|
Direct Parent | catechins |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids3-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativeshydrocarbon derivativesoxacyclic compoundssecondary alcohols |
---|
Substituents | monocyclic benzene moiety3-hydroxyflavonoidether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraromatic heteropolycyclic compoundchromanecatechinorganoheterocyclic compoundalcoholbenzopyran5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compound7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
---|