| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-21 00:14:03 UTC |
|---|
| Update Date | 2025-03-21 18:33:25 UTC |
|---|
| HMDB ID | HMDB0000626 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095737 |
|---|
| Name | Deoxycholic acid |
|---|
| Frequency | 28.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H40O4 |
|---|
| Molecular Mass | 392.2927 |
|---|
| SMILES | CC(CCC(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C |
|---|
| InChI Key | KXGVEGMKQFWNSR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | bile acids, alcohols and derivatives |
|---|
| Direct Parent | bile acids, alcohols and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 12-hydroxysteroids3-hydroxysteroidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl group12-hydroxysteroidcarboxylic acid3-hydroxysteroidhydroxysteroidcyclic alcoholcarboxylic acid derivativebile acid, alcohol, or derivativesaliphatic homopolycyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
