| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:14:04 UTC |
|---|
| Update Date | 2025-03-21 18:33:26 UTC |
|---|
| HMDB ID | HMDB0303467 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00095772 |
|---|
| Name | Dimethylmatairesinol |
|---|
| Frequency | 28.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H26O6 |
|---|
| Molecular Mass | 386.1729 |
|---|
| SMILES | COc1ccc(CC2COC(=O)C2Cc2ccc(OC)c(OC)c2)cc1OC |
|---|
| InChI Key | SNAOLIMFHAAIER-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | furanoid lignans |
|---|
| Subclass | tetrahydrofuran lignans |
|---|
| Direct Parent | dibenzylbutyrolactone lignans |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundscarboxylic acid estersdimethoxybenzenesgamma butyrolactoneshydrocarbon derivativeslignan lactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsphenoxy compoundstetrahydrofurans |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compounddibenzylbutyrolactonealkyl aryl ethercarboxylic acid derivativelignan lactonelactonedimethoxybenzeneorganic oxideo-dimethoxybenzeneorganoheterocyclic compoundtetrahydrofuranmethoxybenzenegamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid esterhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|