Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 00:14:04 UTC |
---|
Update Date | 2025-03-21 18:33:26 UTC |
---|
HMDB ID | HMDB0303467 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00095772 |
---|
Name | Dimethylmatairesinol |
---|
Frequency | 28.9 |
---|
Structure | |
---|
Chemical Formula | C22H26O6 |
---|
Molecular Mass | 386.1729 |
---|
SMILES | COc1ccc(CC2COC(=O)C2Cc2ccc(OC)c(OC)c2)cc1OC |
---|
InChI Key | SNAOLIMFHAAIER-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | lignans, neolignans and related compounds |
---|
Class | furanoid lignans |
---|
Subclass | tetrahydrofuran lignans |
---|
Direct Parent | dibenzylbutyrolactone lignans |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundscarboxylic acid estersdimethoxybenzenesgamma butyrolactoneshydrocarbon derivativeslignan lactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsphenoxy compoundstetrahydrofurans |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compounddibenzylbutyrolactonealkyl aryl ethercarboxylic acid derivativelignan lactonelactonedimethoxybenzeneorganic oxideo-dimethoxybenzeneorganoheterocyclic compoundtetrahydrofuranmethoxybenzenegamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid esterhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
---|