| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:11 UTC |
|---|
| Update Date | 2025-03-21 18:33:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00096071 |
|---|
| Frequency | 28.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O7 |
|---|
| Molecular Mass | 292.0583 |
|---|
| SMILES | Oc1cc(O)c2c(c1)OC(c1cc(O)c(O)c(O)c1)CO2 |
|---|
| InChI Key | UIEFICGXYUMCBM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzodioxanes |
|---|
| Subclass | phenylbenzodioxanes |
|---|
| Direct Parent | phenylbenzo-1,4-dioxanes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativesbenzo-1,4-dioxaneshydrocarbon derivativesoxacyclic compoundspara dioxinspyrogallols and derivatives |
|---|
| Substituents | 2-phenylbenzo-1,4-dioxanebenzo-1,4-dioxanemonocyclic benzene moietyetherpyrogallol derivativebenzenetriol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundpara-dioxinaromatic heteropolycyclic compoundphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|