Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 00:14:12 UTC |
---|
Update Date | 2025-03-21 18:33:30 UTC |
---|
HMDB ID | HMDB0240518 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00096112 |
---|
Name | Formononetin 7-sulfate |
---|
Frequency | 28.8 |
---|
Structure | |
---|
Chemical Formula | C16H12O7S |
---|
Molecular Mass | 348.0304 |
---|
SMILES | COc1ccc(-c2coc3cc(OS(=O)(=O)O)ccc3c2=O)cc1 |
---|
InChI Key | DSZBEWXQBVATQX-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | isoflavonoids |
---|
Subclass | isoflav-2-enes |
---|
Direct Parent | isoflavones |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | alkyl aryl ethersanisolesarylsulfateschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsmethoxybenzenesorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivativessulfuric acid monoesters |
---|
Substituents | phenol ethermonocyclic benzene moietysulfuric acid monoesterether1-benzopyranalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranonearylsulfateorganoheterocyclic compoundisoflavonebenzopyranorganic sulfuric acid or derivativesheteroaromatic compoundmethoxybenzeneoxacycleorganic oxygen compoundpyrananisolesulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
---|