| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:14:12 UTC |
|---|
| Update Date | 2025-03-21 18:33:30 UTC |
|---|
| HMDB ID | HMDB0240518 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00096112 |
|---|
| Name | Formononetin 7-sulfate |
|---|
| Frequency | 28.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O7S |
|---|
| Molecular Mass | 348.0304 |
|---|
| SMILES | COc1ccc(-c2coc3cc(OS(=O)(=O)O)ccc3c2=O)cc1 |
|---|
| InChI Key | DSZBEWXQBVATQX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesarylsulfateschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsmethoxybenzenesorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivativessulfuric acid monoesters |
|---|
| Substituents | phenol ethermonocyclic benzene moietysulfuric acid monoesterether1-benzopyranalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranonearylsulfateorganoheterocyclic compoundisoflavonebenzopyranorganic sulfuric acid or derivativesheteroaromatic compoundmethoxybenzeneoxacycleorganic oxygen compoundpyrananisolesulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|