| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:17 UTC |
|---|
| Update Date | 2025-03-21 18:33:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00096307 |
|---|
| Frequency | 28.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O9P |
|---|
| Molecular Mass | 260.0297 |
|---|
| SMILES | O=[PH](=O)(O)OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | MPYZXGKTQXZUTM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivativesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholmonosaccharideoxacycleorganic oxidealiphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganic phosphoric acid derivativeorganoheterocyclic compound |
|---|
