| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:18 UTC |
|---|
| Update Date | 2025-03-21 18:33:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00096351 |
|---|
| Frequency | 28.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H28NO5+ |
|---|
| Molecular Mass | 290.1962 |
|---|
| SMILES | C[N+](C)(C)C(CCC(=O)O)OC(=O)CCCCCCO |
|---|
| InChI Key | FWIHCTXBXGWREO-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acid esters |
|---|
| Direct Parent | fatty acid esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolscarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganonitrogen compoundsorganopnictogen compoundsshort-chain hydroxy acids and derivativestetraalkylammonium salts |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidtetraalkylammonium saltcarboxylic acid derivativefatty acid esterorganic oxideorganic oxygen compoundcarboxylic acid esterorganonitrogen compounddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltorganooxygen compound |
|---|