Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-21 00:14:27 UTC |
---|
Update Date | 2025-03-21 18:33:37 UTC |
---|
HMDB ID | HMDB0006268 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00096697 |
---|
Name | N-Acetylneuraminate 9-phosphate |
---|
Frequency | 28.6 |
---|
Structure | |
---|
Chemical Formula | C11H20NO12P |
---|
Molecular Mass | 389.0723 |
---|
SMILES | CC(O)=NC1C(O)CC(O)(C(=O)O)OC1C(O)C(O)COP(=O)(O)O |
---|
InChI Key | SQMNIXJSBCSNCI-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | c-glucuronides |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboximidic acidscarboxylic acidshemiacetalshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespropargyl-type 1,3-dipolar organic compoundspyran carboxylic acidssecondary alcohols |
---|
Substituents | carboximidic acidcarbonyl groupcarboxylic acidalpha-hydroxy acidcarboxylic acid derivativepyran carboxylic acidpropargyl-type 1,3-dipolar organic compoundorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundc-glucuronidealcoholpyran carboxylic acid or derivativesorganic 1,3-dipolar compoundhydroxy acidoxacyclemonocarboxylic acid or derivativesphosphoric acid esterpyranmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
---|