| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:28 UTC |
|---|
| Update Date | 2025-03-21 18:33:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00096747 |
|---|
| Frequency | 28.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12O9 |
|---|
| Molecular Mass | 276.0481 |
|---|
| SMILES | CC(=O)OC(=O)CC(O)(CC(=O)OC(C)=O)C(=O)O |
|---|
| InChI Key | LGEVLZIMWKPJJS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | pentacarboxylic acids and derivatives |
|---|
| Direct Parent | pentacarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acid anhydridescarboxylic acidshydrocarbon derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidhydroxy acidpentacarboxylic acid or derivativestertiary alcoholorganic oxideorganic oxygen compoundcarboxylic acid anhydridehydrocarbon derivativeorganooxygen compound |
|---|