| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:29 UTC |
|---|
| Update Date | 2025-03-21 18:33:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00096786 |
|---|
| Frequency | 28.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H30N6O12P3+ |
|---|
| Molecular Mass | 591.1129 |
|---|
| SMILES | C[N+](C)(C)CCOP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1CP(=O)(O)O |
|---|
| InChI Key | ISIAUIMKHNHRIO-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | purine deoxyribonucleotides |
|---|
| Direct Parent | purine 3'-deoxyribonucleoside diphosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesn-substituted imidazolesorganic cationsorganic oxidesorganic phosphonic acids and derivativesorganic pyrophosphatesorganic saltsorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatesphosphocholinesprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetraalkylammonium saltstetrahydrofurans |
|---|
| Substituents | pentose phosphateimidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundorganic cationorganic saltimidolactamorganophosphonic acid derivativeorganoheterocyclic compoundazolen-substituted imidazolealcoholtetraalkylammonium saltazacycletetrahydrofuranquaternary ammonium saltheteroaromatic compoundpurine 3'-deoxyribonucleoside diphosphateorganic pyrophosphatephosphocholineoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|