| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:14:31 UTC |
|---|
| Update Date | 2025-03-21 18:33:39 UTC |
|---|
| HMDB ID | HMDB0251437 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00096865 |
|---|
| Name | Dioxolane guanosine |
|---|
| Frequency | 28.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N5O4 |
|---|
| Molecular Mass | 253.0811 |
|---|
| SMILES | Nc1nc2c(ncn2C2COC(CO)O2)c(=O)[nH]1 |
|---|
| InChI Key | DXNPMWVLIOKPNO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesacetalsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespurines and purine derivativespyrimidonesvinylogous amides |
|---|
| Substituents | meta-dioxolanelactampyrimidonepyrimidineorganic oxideacetalaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholazolen-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundoxacycleorganic oxygen compoundhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
