| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:32 UTC |
|---|
| Update Date | 2025-03-21 18:33:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00096926 |
|---|
| Frequency | 28.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N2O8 |
|---|
| Molecular Mass | 290.075 |
|---|
| SMILES | O=C1CCN(C2OC(C(=O)O)C(O)C(O)C2O)C(=O)N1 |
|---|
| InChI Key | CNCLDVVUJLCOFF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdiazinanesdicarboximidesglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-acyl ureasorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidspyrimidonessecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidmonosaccharidepyrimidonecarboxylic acid derivativepyran carboxylic acidn-glucuronidepyrimidine1,3-diazinanebeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddicarboximideoxaneureideorganoheterocyclic compoundalcoholn-acyl ureacarbonic acid derivativepyran carboxylic acid or derivativesazacyclehydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|