| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:32 UTC |
|---|
| Update Date | 2025-03-21 18:33:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00096929 |
|---|
| Frequency | 28.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H17Cl3O7 |
|---|
| Molecular Mass | 450.004 |
|---|
| SMILES | OC1C(O)C(O)C(Oc2cc(Cl)ccc2Oc2ccc(Cl)cc2Cl)C(O)C1O |
|---|
| InChI Key | NMGRMMYONFYVDW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl chloridescyclitols and derivativescyclohexanolsdiarylethersdichlorobenzeneshydrocarbon derivativesorganochloridesphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol etheretherorganochloridealkyl aryl etherorganohalogen compound1,3-dichlorobenzenearyl chloridechlorobenzenealcoholcyclohexanolcyclitol or derivativescyclic alcoholaryl halidearomatic homomonocyclic compoundorganic oxygen compoundsecondary alcoholhydrocarbon derivativehalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
