Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-21 00:14:35 UTC |
---|
Update Date | 2025-03-21 18:33:41 UTC |
---|
HMDB ID | HMDB0248978 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00097027 |
---|
Name | Benzene-1,2,3-tricarboxylic acid |
---|
Frequency | 28.4 |
---|
Structure | |
---|
Chemical Formula | C9H6O6 |
---|
Molecular Mass | 210.0164 |
---|
SMILES | O=C(O)c1cccc(C(=O)O)c1C(=O)O |
---|
InChI Key | UJMDYLWCYJJYMO-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | tricarboxylic acids and derivatives |
---|
Direct Parent | tricarboxylic acids and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-carboxy-2-haloaromatic compoundsbenzoic acidsbenzoyl derivativeshydrocarbon derivativesorganic oxidesorganooxygen compounds |
---|
Substituents | monocyclic benzene moietycarboxylic acidbenzoylbenzoic acid or derivativestricarboxylic acid or derivativesaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundhydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compound |
---|