| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:35 UTC |
|---|
| Update Date | 2025-03-21 18:33:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097040 |
|---|
| Frequency | 28.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O6 |
|---|
| Molecular Mass | 300.0634 |
|---|
| SMILES | COc1cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2cc1O |
|---|
| InChI Key | QOPZFGJDGCJDCY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 7-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids6-hydroxyflavonoidsalkyl aryl ethersanisolesbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyran6-hydroxyflavonoidheteroaromatic compound1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compoundpyrananisole4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoid7-methoxyflavonoid-skeletonorganooxygen compound |
|---|