| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:37 UTC |
|---|
| Update Date | 2025-03-21 18:33:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097102 |
|---|
| Frequency | 28.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H21NO3 |
|---|
| Molecular Mass | 275.1521 |
|---|
| SMILES | CC(C)NCC(O)COc1cccc2cc(O)ccc12 |
|---|
| InChI Key | LMAJNTFMXMHOBQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersdialkylamineshydrocarbon derivativesorganopnictogen compoundsphenol etherssecondary alcohols |
|---|
| Substituents | alcoholphenol ethersecondary aliphatic amineether1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundalkyl aryl ethersecondary amineorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound2-naphtholorganooxygen compoundamine |
|---|
