| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:38 UTC |
|---|
| Update Date | 2025-03-21 18:33:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097154 |
|---|
| Frequency | 28.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H22O |
|---|
| Molecular Mass | 206.1671 |
|---|
| SMILES | CC(C)(C)c1cccc(C(C)(C)CO)c1 |
|---|
| InChI Key | PFPJZDZKQQRTAM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpropanes |
|---|
| Direct Parent | phenylpropanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolshydrocarbon derivatives |
|---|
| Substituents | phenylpropanealcoholaromatic homomonocyclic compoundorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|