| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:38 UTC |
|---|
| Update Date | 2025-03-21 18:33:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097162 |
|---|
| Frequency | 28.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7O5P |
|---|
| Molecular Mass | 202.0031 |
|---|
| SMILES | O=C(O)c1ccc(P(=O)(O)O)cc1 |
|---|
| InChI Key | IEQICHVXWFGDAN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphonic acids and derivativesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | carboxylic acidbenzoylcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativebenzoic acidorganophosphonic acid derivativeorganooxygen compound |
|---|
