| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:14:39 UTC |
|---|
| Update Date | 2025-03-21 18:33:43 UTC |
|---|
| HMDB ID | HMDB0126029 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097193 |
|---|
| Name | 5,7-dihydroxy-2-(2,3,4-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-one |
|---|
| Frequency | 28.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O7 |
|---|
| Molecular Mass | 304.0583 |
|---|
| SMILES | O=C1CC(c2ccc(O)c(O)c2O)Oc2cc(O)cc(O)c21 |
|---|
| InChI Key | ITFQDSRTZOTUMB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavans |
|---|
| Direct Parent | flavanones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids5-unsubstituted pyrrogallols7-hydroxyflavonoidsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativeschromoneshydrocarbon derivativesorganic oxidesoxacyclic compoundsvinylogous acids |
|---|
| Substituents | monocyclic benzene moietyetheraryl alkyl ketone1-benzopyranflavanone1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketoneorganic oxidechromone5-unsubstituted pyrrogallolaromatic heteropolycyclic compoundchromaneorganoheterocyclic compoundbenzopyranpyrogallol derivativebenzenetriol5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacyclevinylogous acidorganic oxygen compound7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|