Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:14:40 UTC |
---|
Update Date | 2025-03-21 18:33:43 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00097249 |
---|
Frequency | 28.4 |
---|
Structure | |
---|
Chemical Formula | C15H17NO13S |
---|
Molecular Mass | 451.0421 |
---|
SMILES | O=C(CNC(=O)c1ccccc1O)OC1OC(C(=O)O)C(O)C(O)C1OS(=O)(=O)O |
---|
InChI Key | GYRYJAIXEDRPPI-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | acyl glycines |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl sulfatesalpha amino acidsalpha-amino acyl ester of carbohydratesbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshippuric acids and derivativeshydrocarbon derivativesmonosaccharideso-glucuronidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssalicylamidessecondary alcoholssecondary carboxylic acid amidessulfuric acid monoestersvinylogous acids |
---|
Substituents | monocyclic benzene moietycarboxylic acidbenzoylo-glucuronidemonosaccharidepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidsaccharideacetalorganonitrogen compoundalpha-amino acidoxaneorganoheterocyclic compound1,2-diolalcoholalpha-amino acid estern-acylglycinesecondary carboxylic acid amidevinylogous acidsalicylic acid or derivativescarboxylic acid esterdicarboxylic acid or derivativesphenolhydrocarbon derivativesulfuric acid monoestercarbonyl groupglucuronic acid or derivativesaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidbenzamideorganic oxidealkyl sulfateorganopnictogen compoundpyran carboxylic acid or derivativesorganic sulfuric acid or derivativeshippuric acid or derivativesbenzoic acid or derivativeshydroxy acid1-hydroxy-4-unsubstituted benzenoidcarboxamide groupsalicylamideoxacycleorganic oxygen compoundpyranalpha-amino acyl ester of carbohydratesecondary alcoholsulfate-esterbenzenoidorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
---|