| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:40 UTC |
|---|
| Update Date | 2025-03-21 18:33:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097254 |
|---|
| Frequency | 28.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8ClNO5S |
|---|
| Molecular Mass | 264.9812 |
|---|
| SMILES | COc1cc(Cl)c(S(N)(=O)=O)cc1C(=O)O |
|---|
| InChI Key | LMXUPTBLYNTETM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | o-methoxybenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds4-halobenzoic acidsalkyl aryl ethersaminosulfonyl compoundsanisolesaryl chloridesbenzenesulfonamidesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativeschlorobenzeneshalobenzoic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganochloridesorganosulfonamidesphenoxy compounds |
|---|
| Substituents | phenol etherorganosulfonic acid or derivativesethercarboxylic acidorganochloridebenzoylalkyl aryl etherorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxideo-methoxybenzoic acid or derivatives1-carboxy-2-haloaromatic compoundbenzoic acidbenzenesulfonyl grouparyl chloridechlorobenzenehalobenzoic acidbenzenesulfonamide4-halobenzoic acidaminosulfonyl compoundhalobenzoic acid or derivativesmethoxybenzenearyl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativesanisolehydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compoundorganooxygen compound |
|---|