| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:41 UTC |
|---|
| Update Date | 2025-03-21 18:33:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097277 |
|---|
| Frequency | 28.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H19NO2 |
|---|
| Molecular Mass | 245.1416 |
|---|
| SMILES | CC(=O)C1CCCCN1C(=O)Cc1ccccc1 |
|---|
| InChI Key | FIBQRRSUEZSPFT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarboxylic acids and derivativeshydrocarbon derivativesketonesn-acylpiperidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundstertiary carboxylic acid amides |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundazacyclecarboxamide groupcarboxylic acid derivativeketonen-acyl-piperidineorganic oxideorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundpiperidinephenylacetamideorganoheterocyclic compoundorganooxygen compound |
|---|
