| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:43 UTC |
|---|
| Update Date | 2025-03-21 18:33:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097388 |
|---|
| Frequency | 28.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H18O18P4 |
|---|
| Molecular Mass | 513.9444 |
|---|
| SMILES | O=P(O)(O)OCC1C(O)C(O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |
|---|
| InChI Key | JUAPJAROUWFBKF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolscyclitols and derivativeshydrocarbon derivativesmonoalkyl phosphatesorganic oxides |
|---|
| Substituents | cyclohexanolcyclitol or derivativescyclic alcoholorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate1,2-diol |
|---|