Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:14:47 UTC |
---|
Update Date | 2025-03-21 18:33:47 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00097558 |
---|
Frequency | 28.3 |
---|
Structure | |
---|
Chemical Formula | C15H16N6O7S |
---|
Molecular Mass | 424.0801 |
---|
SMILES | Nc1nc(=O)c2c([nH]1)NCC(CNc1ccc(C(=O)OS(=O)(=O)O)cc1)N2C=O |
---|
InChI Key | IEOVAYAYLHQEDX-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pteridines and derivatives |
---|
Subclass | pterins and derivatives |
---|
Direct Parent | pterins and derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | amino acids and derivativesazacyclic compoundsbenzoic acids and derivativesbenzoyl derivativescarbonyl compoundsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenylalkylaminesprimary aminespyrimidonessecondary alkylarylaminessulfuric acid monoesterstertiary carboxylic acid amidesvinylogous amides |
---|
Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl groupamino acid or derivativesbenzoylpyrimidonecarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundvinylogous amidepterinorganic sulfuric acid or derivativesazacycleheteroaromatic compoundbenzoic acid or derivativessecondary aminecarboxamide groupsecondary aliphatic/aromatic aminemonocarboxylic acid or derivativesorganic oxygen compoundphenylalkylaminehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundsulfuric acid esteramineorganooxygen compound |
---|